C23H36F3N5O6 — CID 91098538
[4-(methylamino)phenyl]methyl N-[(2R)-1-[2-(6-aminohexanoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 91098538) has the molecular formula C23H36F3N5O6 and a molecular weight of 535.56 g/mol. Its IUPAC name is [4-(methylamino)phenyl]methyl N-[(2R)-1-[2-(6-aminohexanoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(methylamino)phenyl]methyl N-[(2R)-1-[2-(6-aminohexanoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 91098538 |
| Molecular Formula | C23H36F3N5O6 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | [4-(methylamino)phenyl]methyl N-[(2R)-1-[2-(6-aminohexanoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | CNc1ccc(COC(=O)N[C@H](CC(C)C)C(=O)NNC(=O)CCCCCN)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H35N5O4.C2HF3O2/c1-15(2)13-18(20(28)26-25-19(27)7-5-4-6-12-22)24-21(29)30-14-16-8-10-17(23-3)11-9-16;3-2(4,5)1(6)7/h8-11,15,18,23H,4-7,12-14,22H2,1-3H3,(H,24,29)(H,25,27)(H,26,28);(H,6,7)/t18-;/m1./s1 |
| InChIKey | XYLHYBVMNKNSNW-GMUIIQOCSA-N |
| XLogP | 2.67 |
| TPSA | 171.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|