C14H21F3NO+ — CID 91098557
ethyl-methylidene-[1-[6-methyl-4-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]ethyl]azanium (PubChem CID 91098557) has the molecular formula C14H21F3NO+ and a molecular weight of 276.32 g/mol. Its IUPAC name is ethyl-methylidene-[1-[6-methyl-4-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]ethyl]azanium.
| Compound Name | ethyl-methylidene-[1-[6-methyl-4-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 91098557 |
| Molecular Formula | C14H21F3NO+ |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethyl-methylidene-[1-[6-methyl-4-(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]ethyl]azanium |
| SMILES | C=[N+](CC)C(C)C1C=CC(OCC(F)(F)F)=CC1C |
| InChI | InChI=1S/C14H21F3NO/c1-5-18(4)11(3)13-7-6-12(8-10(13)2)19-9-14(15,16)17/h6-8,10-11,13H,4-5,9H2,1-3H3/q+1 |
| InChIKey | IFBFVMZGSGQIER-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|