About (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate
(4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate (PubChem CID 91098779) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate.
Molecular Properties
| Compound Name | (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate |
| PubChem CID | 91098779 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate |
| SMILES | CCC(=O)On1ccc2c(Cl)nccc21 |
| InChI | InChI=1S/C10H9ClN2O2/c1-2-9(14)15-13-6-4-7-8(13)3-5-12-10(7)11/h3-6H,2H2,1H3 |
| InChIKey | ZXHPXEKAIUSTMZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate?
The IUPAC name of (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate (CID 91098779) is (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate.
What is the SMILES notation for (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate?
The canonical SMILES for (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate is CCC(=O)On1ccc2c(Cl)nccc21.
What is the InChIKey of (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate?
The InChIKey is ZXHPXEKAIUSTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O2/c1-2-9(14)15-13-6-4-7-8(13)3-5-12-10(7)11/h3-6H,2H2,1H3.
What are the key properties of (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate?
(4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate has a molecular weight of 224.65 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloropyrrolo[3,2-c]pyridin-1-yl) propanoate is sourced from PubChem (CID 91098779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).