C17H19F3N2 — CID 91099059
3-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-6,7-dihydroquinolin-6-yl]but-3-en-1-imine (PubChem CID 91099059) has the molecular formula C17H19F3N2 and a molecular weight of 308.35 g/mol. Its IUPAC name is 3-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-6,7-dihydroquinolin-6-yl]but-3-en-1-imine.
| Compound Name | 3-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-6,7-dihydroquinolin-6-yl]but-3-en-1-imine |
|---|---|
| PubChem CID | 91099059 |
| Molecular Formula | C17H19F3N2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-6,7-dihydroquinolin-6-yl]but-3-en-1-imine |
| SMILES | [H]/N=C/CC(=C)C1C=c2ccc(C(C)(C)C(F)(F)F)nc2=CC1 |
| InChI | InChI=1S/C17H19F3N2/c1-11(8-9-21)12-4-6-14-13(10-12)5-7-15(22-14)16(2,3)17(18,19)20/h5-7,9-10,12,21H,1,4,8H2,2-3H3/b21-9+ |
| InChIKey | OYQHWJZKGGWMNU-ZVBGSRNCSA-N |
| XLogP | 3.10 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|