C12H19N3O4 — CID 91099149
N-(2,2-dimethoxyethyl)-5-methyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine-2-carboxamide (PubChem CID 91099149) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5-methyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine-2-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-5-methyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91099149 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5-methyl-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridine-2-carboxamide |
| SMILES | COC(CNC(=O)c1nc2c(o1)CCN(C)C2)OC |
| InChI | InChI=1S/C12H19N3O4/c1-15-5-4-9-8(7-15)14-12(19-9)11(16)13-6-10(17-2)18-3/h10H,4-7H2,1-3H3,(H,13,16) |
| InChIKey | IRIXQEOJABKXIM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|