About 5-chloro-1,4-dihydroisoquinoline
5-chloro-1,4-dihydroisoquinoline (PubChem CID 91099203) has the molecular formula C9H8ClN
and a molecular weight of 165.62 g/mol. Its IUPAC name is 5-chloro-1,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 5-chloro-1,4-dihydroisoquinoline |
| PubChem CID | 91099203 |
| Molecular Formula | C9H8ClN |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 5-chloro-1,4-dihydroisoquinoline |
| SMILES | Clc1cccc2c1CC=NC2 |
| InChI | InChI=1S/C9H8ClN/c10-9-3-1-2-7-6-11-5-4-8(7)9/h1-3,5H,4,6H2 |
| InChIKey | KNLULNFXHUWOEU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-1,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,4-dihydroisoquinoline?
The IUPAC name of 5-chloro-1,4-dihydroisoquinoline (CID 91099203) is 5-chloro-1,4-dihydroisoquinoline.
What is the SMILES notation for 5-chloro-1,4-dihydroisoquinoline?
The canonical SMILES for 5-chloro-1,4-dihydroisoquinoline is Clc1cccc2c1CC=NC2.
What is the InChIKey of 5-chloro-1,4-dihydroisoquinoline?
The InChIKey is KNLULNFXHUWOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN/c10-9-3-1-2-7-6-11-5-4-8(7)9/h1-3,5H,4,6H2.
What are the key properties of 5-chloro-1,4-dihydroisoquinoline?
5-chloro-1,4-dihydroisoquinoline has a molecular weight of 165.62 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,4-dihydroisoquinoline is sourced from PubChem (CID 91099203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).