About methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate
methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate (PubChem CID 91099582) has the molecular formula C23H31N3O5
and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate |
| PubChem CID | 91099582 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(NC2CCCCC2)c(C)n1.COC(=O)c1ccc(OC)c(C)n1 |
| InChI | InChI=1S/C14H20N2O2.C9H11NO3/c1-10-12(16-11-6-4-3-5-7-11)8-9-13(15-10)14(17)18-2;1-6-8(12-2)5-4-7(10-6)9(11)13-3/h8-9,11,16H,3-7H2,1-2H3;4-5H,1-3H3 |
| InChIKey | DQYHNVZOVNWFDH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate?
The IUPAC name of methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate (CID 91099582) is methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate.
What is the SMILES notation for methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate?
The canonical SMILES for methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate is COC(=O)c1ccc(NC2CCCCC2)c(C)n1.COC(=O)c1ccc(OC)c(C)n1.
What is the InChIKey of methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate?
The InChIKey is DQYHNVZOVNWFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2.C9H11NO3/c1-10-12(16-11-6-4-3-5-7-11)8-9-13(15-10)14(17)18-2;1-6-8(12-2)5-4-7(10-6)9(11)13-3/h8-9,11,16H,3-7H2,1-2H3;4-5H,1-3H3.
What are the key properties of methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate?
methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate has a molecular weight of 429.52 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(cyclohexylamino)-6-methylpyridine-2-carboxylate;methyl 5-methoxy-6-methylpyridine-2-carboxylate is sourced from PubChem (CID 91099582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).