About 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine
3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 91100432) has the molecular formula C8H6Br2N2
and a molecular weight of 289.96 g/mol. Its IUPAC name is 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 91100432 |
| Molecular Formula | C8H6Br2N2 |
| Molecular Weight | 289.96 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | BrCc1[nH]c2ncccc2c1Br |
| InChI | InChI=1S/C8H6Br2N2/c9-4-6-7(10)5-2-1-3-11-8(5)12-6/h1-3H,4H2,(H,11,12) |
| InChIKey | WFKRUCCKPIEUDU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.96 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine (CID 91100432) is 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine is BrCc1[nH]c2ncccc2c1Br.
What is the InChIKey of 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is WFKRUCCKPIEUDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2N2/c9-4-6-7(10)5-2-1-3-11-8(5)12-6/h1-3H,4H2,(H,11,12).
What are the key properties of 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine?
3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 289.96 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(bromomethyl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 91100432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).