C21H22FNO5 — CID 91100619
4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-hydroxypentyl)pyrrolidine-2,3-dione (PubChem CID 91100619) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-hydroxypentyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-hydroxypentyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91100619 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-(2-hydroxypentyl)pyrrolidine-2,3-dione |
| SMILES | CCCC(O)CN1CC(C(=O)c2ccc(Cc3ccc(F)cc3)o2)C(=O)C1=O |
| InChI | InChI=1S/C21H22FNO5/c1-2-3-15(24)11-23-12-17(20(26)21(23)27)19(25)18-9-8-16(28-18)10-13-4-6-14(22)7-5-13/h4-9,15,17,24H,2-3,10-12H2,1H3 |
| InChIKey | NLLATAGJRQOFCQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|