About N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide
N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide (PubChem CID 911008) has the molecular formula C9H15N5O
and a molecular weight of 209.25 g/mol. Its IUPAC name is N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide.
Molecular Properties
| Compound Name | N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide |
| PubChem CID | 911008 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide |
| SMILES | CC(=O)N(C)N(C)c1cc(C)nc(N)n1 |
| InChI | InChI=1S/C9H15N5O/c1-6-5-8(12-9(10)11-6)14(4)13(3)7(2)15/h5H,1-4H3,(H2,10,11,12) |
| InChIKey | MACYHYIOLSKNGX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide?
The IUPAC name of N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide (CID 911008) is N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide.
What is the SMILES notation for N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide?
The canonical SMILES for N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide is CC(=O)N(C)N(C)c1cc(C)nc(N)n1.
What is the InChIKey of N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide?
The InChIKey is MACYHYIOLSKNGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O/c1-6-5-8(12-9(10)11-6)14(4)13(3)7(2)15/h5H,1-4H3,(H2,10,11,12).
What are the key properties of N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide?
N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide has a molecular weight of 209.25 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-amino-6-methylpyrimidin-4-yl)-N,N'-dimethylacetohydrazide is sourced from PubChem (CID 911008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).