C13H25N — CID 91100837
N,3-diethyl-4,5,6-trimethylcyclohex-2-en-1-amine (PubChem CID 91100837) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is N,3-diethyl-4,5,6-trimethylcyclohex-2-en-1-amine.
| Compound Name | N,3-diethyl-4,5,6-trimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 91100837 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N,3-diethyl-4,5,6-trimethylcyclohex-2-en-1-amine |
| SMILES | CCNC1C=C(CC)C(C)C(C)C1C |
| InChI | InChI=1S/C13H25N/c1-6-12-8-13(14-7-2)11(5)9(3)10(12)4/h8-11,13-14H,6-7H2,1-5H3 |
| InChIKey | DQJNPRVVBKJWMN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|