C7H5ClN2 — CID 91100935
3-chloropyrazolo[1,5-a]pyridine (PubChem CID 91100935) has the molecular formula C7H5ClN2 and a molecular weight of 152.58 g/mol. Its IUPAC name is 3-chloropyrazolo[1,5-a]pyridine.
| Compound Name | 3-chloropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 91100935 |
| Molecular Formula | C7H5ClN2 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.01 |
| IUPAC Name | 3-chloropyrazolo[1,5-a]pyridine |
| SMILES | Clc1cnn2ccccc12 |
| InChI | InChI=1S/C7H5ClN2/c8-6-5-9-10-4-2-1-3-7(6)10/h1-5H |
| InChIKey | BFRWBELZDURTKY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |