C24H32N4O4S2 — CID 91101123
19-methyl-16-propan-2-yl-13-(4-sulfanylbut-1-enyl)-14-oxa-21-thia-3,10,17,22-tetrazatetracyclo[17.2.1.02,4.03,8]docosa-1(22),5,7-triene-11,15,18-trione (PubChem CID 91101123) has the molecular formula C24H32N4O4S2 and a molecular weight of 504.68 g/mol. Its IUPAC name is 19-methyl-16-propan-2-yl-13-(4-sulfanylbut-1-enyl)-14-oxa-21-thia-3,10,17,22-tetrazatetracyclo[17.2.1.02,4.03,8]docosa-1(22),5,7-triene-11,15,18-trione.
| Compound Name | 19-methyl-16-propan-2-yl-13-(4-sulfanylbut-1-enyl)-14-oxa-21-thia-3,10,17,22-tetrazatetracyclo[17.2.1.02,4.03,8]docosa-1(22),5,7-triene-11,15,18-trione |
|---|---|
| PubChem CID | 91101123 |
| Molecular Formula | C24H32N4O4S2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 19-methyl-16-propan-2-yl-13-(4-sulfanylbut-1-enyl)-14-oxa-21-thia-3,10,17,22-tetrazatetracyclo[17.2.1.02,4.03,8]docosa-1(22),5,7-triene-11,15,18-trione |
| SMILES | CC(C)C1NC(=O)C2(C)CSC(=N2)C2C3C=CC=C(CNC(=O)CC(C=CCCS)OC1=O)N32 |
| InChI | InChI=1S/C24H32N4O4S2/c1-14(2)19-22(30)32-16(8-4-5-10-33)11-18(29)25-12-15-7-6-9-17-20(28(15)17)21-27-24(3,13-34-21)23(31)26-19/h4,6-9,14,16-17,19-20,33H,5,10-13H2,1-3H3,(H,25,29)(H,26,31) |
| InChIKey | CFSUYAMXHIBCHD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|