C17H22ClN4O4S+ — CID 9110116
[(1R)-1-(2-chlorophenyl)-2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-dimethylazanium (PubChem CID 9110116) has the molecular formula C17H22ClN4O4S+ and a molecular weight of 413.91 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)-2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)-2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 9110116 |
| Molecular Formula | C17H22ClN4O4S+ |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)-2-[4-(methylsulfamoyl)-2-nitroanilino]ethyl]-dimethylazanium |
| SMILES | CNS(=O)(=O)c1ccc(NC[C@@H](c2ccccc2Cl)[NH+](C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21ClN4O4S/c1-19-27(25,26)12-8-9-15(16(10-12)22(23)24)20-11-17(21(2)3)13-6-4-5-7-14(13)18/h4-10,17,19-20H,11H2,1-3H3/p+1/t17-/m0/s1 |
| InChIKey | UTSJXUNFCHEJBO-KRWDZBQOSA-O |
| XLogP | 1.45 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|