C22H19ClFNO7S2 — CID 91101230
2-hydroxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate (PubChem CID 91101230) has the molecular formula C22H19ClFNO7S2 and a molecular weight of 527.98 g/mol. Its IUPAC name is 2-hydroxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate.
| Compound Name | 2-hydroxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 91101230 |
| Molecular Formula | C22H19ClFNO7S2 |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 2-hydroxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OCCO)S(=O)(=O)c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C22H19ClFNO7S2/c1-12-18(22(27)32-10-9-26)20(19-13(23)5-4-6-14(19)24)21-15(25-12)11-33(28,29)16-7-2-3-8-17(16)34(21,30)31/h2-8,18,20,26H,9-11H2,1H3 |
| InChIKey | OJTPIBVNAMJGHG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |