About N,N,4-trimethylthian-4-amine
N,N,4-trimethylthian-4-amine (PubChem CID 91101264) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is N,N,4-trimethylthian-4-amine.
Molecular Properties
| Compound Name | N,N,4-trimethylthian-4-amine |
| PubChem CID | 91101264 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | N,N,4-trimethylthian-4-amine |
| SMILES | CN(C)C1(C)CCSCC1 |
| InChI | InChI=1S/C8H17NS/c1-8(9(2)3)4-6-10-7-5-8/h4-7H2,1-3H3 |
| InChIKey | TYASEZJRGULXMZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N,4-trimethylthian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,4-trimethylthian-4-amine?
The IUPAC name of N,N,4-trimethylthian-4-amine (CID 91101264) is N,N,4-trimethylthian-4-amine.
What is the SMILES notation for N,N,4-trimethylthian-4-amine?
The canonical SMILES for N,N,4-trimethylthian-4-amine is CN(C)C1(C)CCSCC1.
What is the InChIKey of N,N,4-trimethylthian-4-amine?
The InChIKey is TYASEZJRGULXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS/c1-8(9(2)3)4-6-10-7-5-8/h4-7H2,1-3H3.
What are the key properties of N,N,4-trimethylthian-4-amine?
N,N,4-trimethylthian-4-amine has a molecular weight of 159.30 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,4-trimethylthian-4-amine is sourced from PubChem (CID 91101264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).