C14H17BrO6S — CID 91101283
methyl (1R,3R,5S)-3-(4-bromophenyl)sulfonyloxy-5-hydroxycyclohexane-1-carboxylate (PubChem CID 91101283) has the molecular formula C14H17BrO6S and a molecular weight of 393.26 g/mol. Its IUPAC name is methyl (1R,3R,5S)-3-(4-bromophenyl)sulfonyloxy-5-hydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3R,5S)-3-(4-bromophenyl)sulfonyloxy-5-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91101283 |
| Molecular Formula | C14H17BrO6S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | methyl (1R,3R,5S)-3-(4-bromophenyl)sulfonyloxy-5-hydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O)C[C@H](OS(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C14H17BrO6S/c1-20-14(17)9-6-11(16)8-12(7-9)21-22(18,19)13-4-2-10(15)3-5-13/h2-5,9,11-12,16H,6-8H2,1H3/t9-,11+,12-/m1/s1 |
| InChIKey | VPKBHSIOHKNSIW-ADEWGFFLSA-N |
| XLogP | 1.86 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|