About ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole
ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole (PubChem CID 91101310) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole.
Molecular Properties
| Compound Name | ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole |
| PubChem CID | 91101310 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole |
| SMILES | CC.CC.CC1=NC2=C(CCC2)C1 |
| InChI | InChI=1S/C8H11N.2C2H6/c1-6-5-7-3-2-4-8(7)9-6;2*1-2/h2-5H2,1H3;2*1-2H3 |
| InChIKey | ZVPJTZDBYBYRBH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The IUPAC name of ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole (CID 91101310) is ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole.
What is the SMILES notation for ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The canonical SMILES for ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole is CC.CC.CC1=NC2=C(CCC2)C1.
What is the InChIKey of ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The InChIKey is ZVPJTZDBYBYRBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.2C2H6/c1-6-5-7-3-2-4-8(7)9-6;2*1-2/h2-5H2,1H3;2*1-2H3.
What are the key properties of ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole has a molecular weight of 181.32 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole is sourced from PubChem (CID 91101310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).