C33H60O3Si2 — CID 91101490
(1S)-1-[(1S,7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol (PubChem CID 91101490) has the molecular formula C33H60O3Si2 and a molecular weight of 561.01 g/mol. Its IUPAC name is (1S)-1-[(1S,7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol.
| Compound Name | (1S)-1-[(1S,7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol |
|---|---|
| PubChem CID | 91101490 |
| Molecular Formula | C33H60O3Si2 |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | (1S)-1-[(1S,7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanol |
| SMILES | C=C1C(=CC=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)O)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H60O3Si2/c1-23-26(17-16-25-15-14-20-33(9)28(24(2)34)18-19-29(25)33)21-27(35-37(10,11)31(3,4)5)22-30(23)36-38(12,13)32(6,7)8/h16-17,24,27-30,34H,1,14-15,18-22H2,2-13H3/t24-,27+,28+,29?,30-,33+/m0/s1 |
| InChIKey | GLVUSZOKHDZTKQ-DXFBLPODSA-N |
| XLogP | 9.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|