C15H15NO3 — CID 91102040
4-(4-methoxynaphthalen-1-yl)-4-oxobutanamide (PubChem CID 91102040) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-(4-methoxynaphthalen-1-yl)-4-oxobutanamide.
| Compound Name | 4-(4-methoxynaphthalen-1-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 91102040 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-(4-methoxynaphthalen-1-yl)-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)CCC(N)=O)c2ccccc12 |
| InChI | InChI=1S/C15H15NO3/c1-19-14-8-6-11(13(17)7-9-15(16)18)10-4-2-3-5-12(10)14/h2-6,8H,7,9H2,1H3,(H2,16,18) |
| InChIKey | GZXCSGCUKGFWOD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |