C19H34F2O — CID 91102503
1-(2,2-difluoro-3-methylbut-3-enoxy)-5,6-dimethyl-4-(2-methylpropyl)oct-2-ene (PubChem CID 91102503) has the molecular formula C19H34F2O and a molecular weight of 316.48 g/mol. Its IUPAC name is 1-(2,2-difluoro-3-methylbut-3-enoxy)-5,6-dimethyl-4-(2-methylpropyl)oct-2-ene.
| Compound Name | 1-(2,2-difluoro-3-methylbut-3-enoxy)-5,6-dimethyl-4-(2-methylpropyl)oct-2-ene |
|---|---|
| PubChem CID | 91102503 |
| Molecular Formula | C19H34F2O |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-(2,2-difluoro-3-methylbut-3-enoxy)-5,6-dimethyl-4-(2-methylpropyl)oct-2-ene |
| SMILES | C=C(C)C(F)(F)COCC=CC(CC(C)C)C(C)C(C)CC |
| InChI | InChI=1S/C19H34F2O/c1-8-16(6)17(7)18(12-14(2)3)10-9-11-22-13-19(20,21)15(4)5/h9-10,14,16-18H,4,8,11-13H2,1-3,5-7H3 |
| InChIKey | DFQWPQIKLKLYDO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|