About 3-thiophen-3-yl-6,7-dihydro-1H-indazole
3-thiophen-3-yl-6,7-dihydro-1H-indazole (PubChem CID 91102586) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-thiophen-3-yl-6,7-dihydro-1H-indazole.
Molecular Properties
| Compound Name | 3-thiophen-3-yl-6,7-dihydro-1H-indazole |
| PubChem CID | 91102586 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-thiophen-3-yl-6,7-dihydro-1H-indazole |
| SMILES | C1=Cc2c(-c3ccsc3)n[nH]c2CC1 |
| InChI | InChI=1S/C11H10N2S/c1-2-4-10-9(3-1)11(13-12-10)8-5-6-14-7-8/h1,3,5-7H,2,4H2,(H,12,13) |
| InChIKey | VOHLDHXZLHKTJN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-thiophen-3-yl-6,7-dihydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-3-yl-6,7-dihydro-1H-indazole?
The IUPAC name of 3-thiophen-3-yl-6,7-dihydro-1H-indazole (CID 91102586) is 3-thiophen-3-yl-6,7-dihydro-1H-indazole.
What is the SMILES notation for 3-thiophen-3-yl-6,7-dihydro-1H-indazole?
The canonical SMILES for 3-thiophen-3-yl-6,7-dihydro-1H-indazole is C1=Cc2c(-c3ccsc3)n[nH]c2CC1.
What is the InChIKey of 3-thiophen-3-yl-6,7-dihydro-1H-indazole?
The InChIKey is VOHLDHXZLHKTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-2-4-10-9(3-1)11(13-12-10)8-5-6-14-7-8/h1,3,5-7H,2,4H2,(H,12,13).
What are the key properties of 3-thiophen-3-yl-6,7-dihydro-1H-indazole?
3-thiophen-3-yl-6,7-dihydro-1H-indazole has a molecular weight of 202.28 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-3-yl-6,7-dihydro-1H-indazole is sourced from PubChem (CID 91102586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).