About 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione
6-hydroxy-6-methylcyclohex-4-ene-1,3-dione (PubChem CID 91102626) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione.
Molecular Properties
| Compound Name | 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione |
| PubChem CID | 91102626 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione |
| SMILES | CC1(O)C=CC(=O)CC1=O |
| InChI | InChI=1S/C7H8O3/c1-7(10)3-2-5(8)4-6(7)9/h2-3,10H,4H2,1H3 |
| InChIKey | KDFSGQWNRDEAKI-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione?
The IUPAC name of 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione (CID 91102626) is 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione.
What is the SMILES notation for 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione?
The canonical SMILES for 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione is CC1(O)C=CC(=O)CC1=O.
What is the InChIKey of 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione?
The InChIKey is KDFSGQWNRDEAKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-7(10)3-2-5(8)4-6(7)9/h2-3,10H,4H2,1H3.
What are the key properties of 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione?
6-hydroxy-6-methylcyclohex-4-ene-1,3-dione has a molecular weight of 140.14 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-6-methylcyclohex-4-ene-1,3-dione is sourced from PubChem (CID 91102626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).