C9H8F6O — CID 91102746
1,1,1,7,7,7-hexafluoro-2,6-dimethylhepta-2,5-dien-4-one (PubChem CID 91102746) has the molecular formula C9H8F6O and a molecular weight of 246.15 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoro-2,6-dimethylhepta-2,5-dien-4-one.
| Compound Name | 1,1,1,7,7,7-hexafluoro-2,6-dimethylhepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 91102746 |
| Molecular Formula | C9H8F6O |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoro-2,6-dimethylhepta-2,5-dien-4-one |
| SMILES | CC(=CC(=O)C=C(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6O/c1-5(8(10,11)12)3-7(16)4-6(2)9(13,14)15/h3-4H,1-2H3 |
| InChIKey | LTFIWGGPBLBQPT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|