C19H30N2+2 — CID 91103051
3,4-dimethylpent-3-enylidene-methyl-[3-(2,3,4-trimethyl-2,5-dihydropyridin-1-ium-1-yl)propa-1,2-dienyl]azanium (PubChem CID 91103051) has the molecular formula C19H30N2+2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 3,4-dimethylpent-3-enylidene-methyl-[3-(2,3,4-trimethyl-2,5-dihydropyridin-1-ium-1-yl)propa-1,2-dienyl]azanium.
| Compound Name | 3,4-dimethylpent-3-enylidene-methyl-[3-(2,3,4-trimethyl-2,5-dihydropyridin-1-ium-1-yl)propa-1,2-dienyl]azanium |
|---|---|
| PubChem CID | 91103051 |
| Molecular Formula | C19H30N2+2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 3,4-dimethylpent-3-enylidene-methyl-[3-(2,3,4-trimethyl-2,5-dihydropyridin-1-ium-1-yl)propa-1,2-dienyl]azanium |
| SMILES | CC(C)=C(C)C/C=[N+](\C)C=C=C[N+]1=CCC(C)=C(C)C1C |
| InChI | InChI=1S/C19H30N2/c1-15(2)16(3)9-13-20(7)11-8-12-21-14-10-17(4)18(5)19(21)6/h11-14,19H,9-10H2,1-7H3/q+2/b20-13+ |
| InChIKey | VHSXKBLTKBYDKJ-DEDYPNTBSA-N |
| XLogP | 4.28 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|