About 6-nitro-3,3a,4,7-tetrahydro-2H-indole
6-nitro-3,3a,4,7-tetrahydro-2H-indole (PubChem CID 91103458) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 6-nitro-3,3a,4,7-tetrahydro-2H-indole.
Molecular Properties
| Compound Name | 6-nitro-3,3a,4,7-tetrahydro-2H-indole |
| PubChem CID | 91103458 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 6-nitro-3,3a,4,7-tetrahydro-2H-indole |
| SMILES | O=[N+]([O-])C1=CCC2CCN=C2C1 |
| InChI | InChI=1S/C8H10N2O2/c11-10(12)7-2-1-6-3-4-9-8(6)5-7/h2,6H,1,3-5H2 |
| InChIKey | UCTWQPBPGJATKG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-3,3a,4,7-tetrahydro-2H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-3,3a,4,7-tetrahydro-2H-indole?
The IUPAC name of 6-nitro-3,3a,4,7-tetrahydro-2H-indole (CID 91103458) is 6-nitro-3,3a,4,7-tetrahydro-2H-indole.
What is the SMILES notation for 6-nitro-3,3a,4,7-tetrahydro-2H-indole?
The canonical SMILES for 6-nitro-3,3a,4,7-tetrahydro-2H-indole is O=[N+]([O-])C1=CCC2CCN=C2C1.
What is the InChIKey of 6-nitro-3,3a,4,7-tetrahydro-2H-indole?
The InChIKey is UCTWQPBPGJATKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-10(12)7-2-1-6-3-4-9-8(6)5-7/h2,6H,1,3-5H2.
What are the key properties of 6-nitro-3,3a,4,7-tetrahydro-2H-indole?
6-nitro-3,3a,4,7-tetrahydro-2H-indole has a molecular weight of 166.18 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-3,3a,4,7-tetrahydro-2H-indole is sourced from PubChem (CID 91103458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).