C24H25F6N3O2 — CID 91103562
[(1S,4S)-5-[(1S)-1-[2,3-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 91103562) has the molecular formula C24H25F6N3O2 and a molecular weight of 501.47 g/mol. Its IUPAC name is [(1S,4S)-5-[(1S)-1-[2,3-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(1S,4S)-5-[(1S)-1-[2,3-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 91103562 |
| Molecular Formula | C24H25F6N3O2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | [(1S,4S)-5-[(1S)-1-[2,3-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1c(OCC(F)(F)F)ccc([C@H](C)N2C[C@@H]3C[C@H]2CN3C(=O)c2ccc(C(F)(F)F)nc2)c1C |
| InChI | InChI=1S/C24H25F6N3O2/c1-13-14(2)20(35-12-23(25,26)27)6-5-19(13)15(3)32-10-18-8-17(32)11-33(18)22(34)16-4-7-21(31-9-16)24(28,29)30/h4-7,9,15,17-18H,8,10-12H2,1-3H3/t15-,17-,18-/m0/s1 |
| InChIKey | JZZPNLUCWCVOON-SZMVWBNQSA-N |
| XLogP | 5.32 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |