C24H29FN2O2 — CID 91103598
2-[[4-(2-fluoropropan-2-yloxy)phenyl]methyl]-7-methyl-5-piperidin-4-ylisoindol-1-ol (PubChem CID 91103598) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[[4-(2-fluoropropan-2-yloxy)phenyl]methyl]-7-methyl-5-piperidin-4-ylisoindol-1-ol.
| Compound Name | 2-[[4-(2-fluoropropan-2-yloxy)phenyl]methyl]-7-methyl-5-piperidin-4-ylisoindol-1-ol |
|---|---|
| PubChem CID | 91103598 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[[4-(2-fluoropropan-2-yloxy)phenyl]methyl]-7-methyl-5-piperidin-4-ylisoindol-1-ol |
| SMILES | Cc1cc(C2CCNCC2)cc2cn(Cc3ccc(OC(C)(C)F)cc3)c(O)c12 |
| InChI | InChI=1S/C24H29FN2O2/c1-16-12-19(18-8-10-26-11-9-18)13-20-15-27(23(28)22(16)20)14-17-4-6-21(7-5-17)29-24(2,3)25/h4-7,12-13,15,18,26,28H,8-11,14H2,1-3H3 |
| InChIKey | CJTSTEOSHTYKAW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |