About 5-methyl-1H-indene;propane
5-methyl-1H-indene;propane (PubChem CID 91103814) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is 5-methyl-1H-indene;propane.
Molecular Properties
| Compound Name | 5-methyl-1H-indene;propane |
| PubChem CID | 91103814 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 5-methyl-1H-indene;propane |
| SMILES | CCC.Cc1ccc2c(c1)C=CC2 |
| InChI | InChI=1S/C10H10.C3H8/c1-8-5-6-9-3-2-4-10(9)7-8;1-3-2/h2,4-7H,3H2,1H3;3H2,1-2H3 |
| InChIKey | PQSQLLQXBWYAAR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-methyl-1H-indene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-indene;propane?
The IUPAC name of 5-methyl-1H-indene;propane (CID 91103814) is 5-methyl-1H-indene;propane.
What is the SMILES notation for 5-methyl-1H-indene;propane?
The canonical SMILES for 5-methyl-1H-indene;propane is CCC.Cc1ccc2c(c1)C=CC2.
What is the InChIKey of 5-methyl-1H-indene;propane?
The InChIKey is PQSQLLQXBWYAAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C3H8/c1-8-5-6-9-3-2-4-10(9)7-8;1-3-2/h2,4-7H,3H2,1H3;3H2,1-2H3.
What are the key properties of 5-methyl-1H-indene;propane?
5-methyl-1H-indene;propane has a molecular weight of 174.29 g/mol, XLogP of 3.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-indene;propane is sourced from PubChem (CID 91103814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).