C27H27ClN7O4+ — CID 91104040
(2R)-1-[2-(3-chlorophenyl)-2-hydroxy-2-(1-oxidopyridin-1-ium-3-yl)acetyl]-2-methyl-N-[[2-(tetrazol-1-yl)phenyl]methyl]pyrrolidin-1-ium-1-carboxamide (PubChem CID 91104040) has the molecular formula C27H27ClN7O4+ and a molecular weight of 549.01 g/mol. Its IUPAC name is (2R)-1-[2-(3-chlorophenyl)-2-hydroxy-2-(1-oxidopyridin-1-ium-3-yl)acetyl]-2-methyl-N-[[2-(tetrazol-1-yl)phenyl]methyl]pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[2-(3-chlorophenyl)-2-hydroxy-2-(1-oxidopyridin-1-ium-3-yl)acetyl]-2-methyl-N-[[2-(tetrazol-1-yl)phenyl]methyl]pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91104040 |
| Molecular Formula | C27H27ClN7O4+ |
| Molecular Weight | 549.01 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | (2R)-1-[2-(3-chlorophenyl)-2-hydroxy-2-(1-oxidopyridin-1-ium-3-yl)acetyl]-2-methyl-N-[[2-(tetrazol-1-yl)phenyl]methyl]pyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)NCc1ccccc1-n1cnnn1)C(=O)C(O)(c1cccc(Cl)c1)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C27H26ClN7O4/c1-19-7-6-14-35(19,26(37)29-16-20-8-2-3-12-24(20)34-18-30-31-32-34)25(36)27(38,21-9-4-11-23(28)15-21)22-10-5-13-33(39)17-22/h2-5,8-13,15,17-19,38H,6-7,14,16H2,1H3/p+1/t19-,27?,35?/m1/s1 |
| InChIKey | YOYDAFQTPVNCEK-OCZLMSGVSA-O |
| XLogP | 2.62 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.01 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|