C17H31NO3 — CID 91104328
tert-butyl 4-(3-hydroxy-2,2,3-trimethylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 91104328) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is tert-butyl 4-(3-hydroxy-2,2,3-trimethylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-hydroxy-2,2,3-trimethylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 91104328 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | tert-butyl 4-(3-hydroxy-2,2,3-trimethylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(CC(C)(C)C(C)(C)O)CC1 |
| InChI | InChI=1S/C17H31NO3/c1-15(2,3)21-14(19)18-10-8-13(9-11-18)12-16(4,5)17(6,7)20/h8,20H,9-12H2,1-7H3 |
| InChIKey | UHNPQLDHGDHBOY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|