C8H19NO2 — CID 91104408
1,3-dimethylpiperidin-4-ol;methanol (PubChem CID 91104408) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,3-dimethylpiperidin-4-ol;methanol.
| Compound Name | 1,3-dimethylpiperidin-4-ol;methanol |
|---|---|
| PubChem CID | 91104408 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1,3-dimethylpiperidin-4-ol;methanol |
| SMILES | CC1CN(C)CCC1O.CO |
| InChI | InChI=1S/C7H15NO.CH4O/c1-6-5-8(2)4-3-7(6)9;1-2/h6-7,9H,3-5H2,1-2H3;2H,1H3 |
| InChIKey | GVPJYDVZISAULA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |