About butan-2-ylcyclohexane;methanol
butan-2-ylcyclohexane;methanol (PubChem CID 91105162) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is butan-2-ylcyclohexane;methanol.
Molecular Properties
| Compound Name | butan-2-ylcyclohexane;methanol |
| PubChem CID | 91105162 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | butan-2-ylcyclohexane;methanol |
| SMILES | CCC(C)C1CCCCC1.CO |
| InChI | InChI=1S/C10H20.CH4O/c1-3-9(2)10-7-5-4-6-8-10;1-2/h9-10H,3-8H2,1-2H3;2H,1H3 |
| InChIKey | ANTXQRGTBJJMFA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-ylcyclohexane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylcyclohexane;methanol?
The IUPAC name of butan-2-ylcyclohexane;methanol (CID 91105162) is butan-2-ylcyclohexane;methanol.
What is the SMILES notation for butan-2-ylcyclohexane;methanol?
The canonical SMILES for butan-2-ylcyclohexane;methanol is CCC(C)C1CCCCC1.CO.
What is the InChIKey of butan-2-ylcyclohexane;methanol?
The InChIKey is ANTXQRGTBJJMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.CH4O/c1-3-9(2)10-7-5-4-6-8-10;1-2/h9-10H,3-8H2,1-2H3;2H,1H3.
What are the key properties of butan-2-ylcyclohexane;methanol?
butan-2-ylcyclohexane;methanol has a molecular weight of 172.31 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylcyclohexane;methanol is sourced from PubChem (CID 91105162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).