About [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium
[2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium (PubChem CID 91105268) has the molecular formula C13H22NO5+
and a molecular weight of 272.32 g/mol. Its IUPAC name is [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium.
Molecular Properties
| Compound Name | [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium |
| PubChem CID | 91105268 |
| Molecular Formula | C13H22NO5+ |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium |
| SMILES | CCC(O)(C[N+](C)(C)C)C1(C(=O)O)C(=O)CCC1=O |
| InChI | InChI=1S/C13H21NO5/c1-5-12(19,8-14(2,3)4)13(11(17)18)9(15)6-7-10(13)16/h19H,5-8H2,1-4H3/p+1 |
| InChIKey | ZLNGVPXYLAHLPZ-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium?
The IUPAC name of [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium (CID 91105268) is [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium.
What is the SMILES notation for [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium?
The canonical SMILES for [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium is CCC(O)(C[N+](C)(C)C)C1(C(=O)O)C(=O)CCC1=O.
What is the InChIKey of [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium?
The InChIKey is ZLNGVPXYLAHLPZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H21NO5/c1-5-12(19,8-14(2,3)4)13(11(17)18)9(15)6-7-10(13)16/h19H,5-8H2,1-4H3/p+1.
What are the key properties of [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium?
[2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium has a molecular weight of 272.32 g/mol, XLogP of -0.16, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-carboxy-2,5-dioxocyclopentyl)-2-hydroxybutyl]-trimethylazanium is sourced from PubChem (CID 91105268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).