C20H28O2 — CID 91105857
(8S,9S,10R,13R,14S,17R)-4-hydroxy-10,13,17-trimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 91105857) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-4-hydroxy-10,13,17-trimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13R,14S,17R)-4-hydroxy-10,13,17-trimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91105857 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-4-hydroxy-10,13,17-trimethyl-4,5,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]3C=CC4C(O)C(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H28O2/c1-12-4-6-14-13-5-7-16-18(22)17(21)9-11-20(16,3)15(13)8-10-19(12,14)2/h5,7,9,11-16,18,22H,4,6,8,10H2,1-3H3/t12-,13+,14+,15+,16?,18?,19-,20-/m1/s1 |
| InChIKey | YQKYIPUGQBJNCX-FCWHVADSSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|