About 1-cyclohexa-1,5-dien-1-ylethanamine
1-cyclohexa-1,5-dien-1-ylethanamine (PubChem CID 91106318) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-ylethanamine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-ylethanamine |
| PubChem CID | 91106318 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-ylethanamine |
| SMILES | CC(N)C1=CCCC=C1 |
| InChI | InChI=1S/C8H13N/c1-7(9)8-5-3-2-4-6-8/h3,5-7H,2,4,9H2,1H3 |
| InChIKey | DDFHCNSXPQQUHD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,5-dien-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-ylethanamine?
The IUPAC name of 1-cyclohexa-1,5-dien-1-ylethanamine (CID 91106318) is 1-cyclohexa-1,5-dien-1-ylethanamine.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-ylethanamine?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-ylethanamine is CC(N)C1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-ylethanamine?
The InChIKey is DDFHCNSXPQQUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-7(9)8-5-3-2-4-6-8/h3,5-7H,2,4,9H2,1H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-ylethanamine?
1-cyclohexa-1,5-dien-1-ylethanamine has a molecular weight of 123.20 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-ylethanamine is sourced from PubChem (CID 91106318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).