C31H29ClN6O2 — CID 91106451
2-chloro-N-methyl-N-[4-[[[2-oxo-6-[2-(propan-2-ylamino)pyrimidin-5-yl]-1,3-dihydroindol-3-yl]-phenylmethylidene]amino]phenyl]acetamide (PubChem CID 91106451) has the molecular formula C31H29ClN6O2 and a molecular weight of 553.07 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[4-[[[2-oxo-6-[2-(propan-2-ylamino)pyrimidin-5-yl]-1,3-dihydroindol-3-yl]-phenylmethylidene]amino]phenyl]acetamide.
| Compound Name | 2-chloro-N-methyl-N-[4-[[[2-oxo-6-[2-(propan-2-ylamino)pyrimidin-5-yl]-1,3-dihydroindol-3-yl]-phenylmethylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 91106451 |
| Molecular Formula | C31H29ClN6O2 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 2-chloro-N-methyl-N-[4-[[[2-oxo-6-[2-(propan-2-ylamino)pyrimidin-5-yl]-1,3-dihydroindol-3-yl]-phenylmethylidene]amino]phenyl]acetamide |
| SMILES | CC(C)Nc1ncc(-c2ccc3c(c2)NC(=O)C3/C(=N/c2ccc(N(C)C(=O)CCl)cc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C31H29ClN6O2/c1-19(2)35-31-33-17-22(18-34-31)21-9-14-25-26(15-21)37-30(40)28(25)29(20-7-5-4-6-8-20)36-23-10-12-24(13-11-23)38(3)27(39)16-32/h4-15,17-19,28H,16H2,1-3H3,(H,37,40)(H,33,34,35)/b36-29+ |
| InChIKey | NNPTUALANZFTLK-ZONNCAFXSA-N |
| XLogP | 6.02 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|