About (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene
(3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene (PubChem CID 91106786) has the molecular formula C23H33N
and a molecular weight of 323.52 g/mol. Its IUPAC name is (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene.
Molecular Properties
| Compound Name | (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene |
| PubChem CID | 91106786 |
| Molecular Formula | C23H33N |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene |
| SMILES | CC.Cc1ccccc1.c1ccc(C[C@H]2CN3CCC2CC3)cc1 |
| InChI | InChI=1S/C14H19N.C7H8.C2H6/c1-2-4-12(5-3-1)10-14-11-15-8-6-13(14)7-9-15;1-7-5-3-2-4-6-7;1-2/h1-5,13-14H,6-11H2;2-6H,1H3;1-2H3/t14-;;/m0../s1 |
| InChIKey | QYBHNRIICJNRNU-UTLKBRERSA-N |
| XLogP | 5.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene?
The IUPAC name of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene (CID 91106786) is (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene.
What is the SMILES notation for (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene?
The canonical SMILES for (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene is CC.Cc1ccccc1.c1ccc(C[C@H]2CN3CCC2CC3)cc1.
What is the InChIKey of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene?
The InChIKey is QYBHNRIICJNRNU-UTLKBRERSA-N. The full InChI is InChI=1S/C14H19N.C7H8.C2H6/c1-2-4-12(5-3-1)10-14-11-15-8-6-13(14)7-9-15;1-7-5-3-2-4-6-7;1-2/h1-5,13-14H,6-11H2;2-6H,1H3;1-2H3/t14-;;/m0../s1.
What are the key properties of (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene?
(3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene has a molecular weight of 323.52 g/mol, XLogP of 5.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-benzyl-1-azabicyclo[2.2.2]octane;ethane;toluene is sourced from PubChem (CID 91106786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).