C21H27N3O3S2 — CID 91106896
N'-(4-oxo-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl)benzenesulfonohydrazide (PubChem CID 91106896) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N'-(4-oxo-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl)benzenesulfonohydrazide.
| Compound Name | N'-(4-oxo-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 91106896 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N'-(4-oxo-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl)benzenesulfonohydrazide |
| SMILES | O=C(CC(CSc1ccccc1)NNS(=O)(=O)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C21H27N3O3S2/c25-21(24-14-8-3-9-15-24)16-18(17-28-19-10-4-1-5-11-19)22-23-29(26,27)20-12-6-2-7-13-20/h1-2,4-7,10-13,18,22-23H,3,8-9,14-17H2 |
| InChIKey | KSSLQYBDNDIPPB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|