About methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate
methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 91107602) has the molecular formula C28H44F2O7
and a molecular weight of 530.65 g/mol. Its IUPAC name is methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| PubChem CID | 91107602 |
| Molecular Formula | C28H44F2O7 |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(=O)CC=C1C(OC2CCCCO2)CC(OC(C)=O)C1CCCCCCC(=O)OC |
| InChI | InChI=1S/C28H44F2O7/c1-4-5-17-28(29,30)25(32)16-15-22-21(12-8-6-7-9-13-26(33)34-3)23(36-20(2)31)19-24(22)37-27-14-10-11-18-35-27/h15,21,23-24,27H,4-14,16-19H2,1-3H3 |
| InChIKey | MRXLIZJICVDLFN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate?
The IUPAC name of methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate (CID 91107602) is methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate is CCCCC(F)(F)C(=O)CC=C1C(OC2CCCCO2)CC(OC(C)=O)C1CCCCCCC(=O)OC.
What is the InChIKey of methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate?
The InChIKey is MRXLIZJICVDLFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44F2O7/c1-4-5-17-28(29,30)25(32)16-15-22-21(12-8-6-7-9-13-26(33)34-3)23(36-20(2)31)19-24(22)37-27-14-10-11-18-35-27/h15,21,23-24,27H,4-14,16-19H2,1-3H3.
What are the key properties of methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate?
methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate has a molecular weight of 530.65 g/mol, XLogP of 6.07, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[5-acetyloxy-2-(4,4-difluoro-3-oxooctylidene)-3-(oxan-2-yloxy)cyclopentyl]heptanoate is sourced from PubChem (CID 91107602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).