About 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal
2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal (PubChem CID 91107633) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal.
Molecular Properties
| Compound Name | 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal |
| PubChem CID | 91107633 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal |
| SMILES | CCOC1=CCC(CC(C=O)=C(C)C)C=C1 |
| InChI | InChI=1S/C14H20O2/c1-4-16-14-7-5-12(6-8-14)9-13(10-15)11(2)3/h5,7-8,10,12H,4,6,9H2,1-3H3 |
| InChIKey | KLCVNXQTTXALOG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal?
The IUPAC name of 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal (CID 91107633) is 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal.
What is the SMILES notation for 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal?
The canonical SMILES for 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal is CCOC1=CCC(CC(C=O)=C(C)C)C=C1.
What is the InChIKey of 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal?
The InChIKey is KLCVNXQTTXALOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-4-16-14-7-5-12(6-8-14)9-13(10-15)11(2)3/h5,7-8,10,12H,4,6,9H2,1-3H3.
What are the key properties of 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal?
2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal has a molecular weight of 220.31 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethoxycyclohexa-2,4-dien-1-yl)methyl]-3-methylbut-2-enal is sourced from PubChem (CID 91107633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).