C9H3Br2F7 — CID 91107676
1,3-dibromo-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (PubChem CID 91107676) has the molecular formula C9H3Br2F7 and a molecular weight of 403.92 g/mol. Its IUPAC name is 1,3-dibromo-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene.
| Compound Name | 1,3-dibromo-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 91107676 |
| Molecular Formula | C9H3Br2F7 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 401.85 |
| IUPAC Name | 1,3-dibromo-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| SMILES | FC(F)(F)C(F)(c1cc(Br)cc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C9H3Br2F7/c10-5-1-4(2-6(11)3-5)7(12,8(13,14)15)9(16,17)18/h1-3H |
| InChIKey | SCSUYDYWFTXXDT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |