C32H33FN4O6S — CID 91108268
(6S,9aS)-N-(4-acetylphenyl)-8-[2-(3-fluorophenyl)ethyl]-6-[methylsulfonyl(phenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide (PubChem CID 91108268) has the molecular formula C32H33FN4O6S and a molecular weight of 620.70 g/mol. Its IUPAC name is (6S,9aS)-N-(4-acetylphenyl)-8-[2-(3-fluorophenyl)ethyl]-6-[methylsulfonyl(phenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide.
| Compound Name | (6S,9aS)-N-(4-acetylphenyl)-8-[2-(3-fluorophenyl)ethyl]-6-[methylsulfonyl(phenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 91108268 |
| Molecular Formula | C32H33FN4O6S |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | (6S,9aS)-N-(4-acetylphenyl)-8-[2-(3-fluorophenyl)ethyl]-6-[methylsulfonyl(phenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2CCC(=O)N3[C@@H]2CN(CCc2cccc(F)c2)C(=O)[C@H]3C(c2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C32H33FN4O6S/c1-21(38)23-11-13-26(14-12-23)34-32(41)36-18-16-28(39)37-27(36)20-35(17-15-22-7-6-10-25(33)19-22)31(40)29(37)30(44(2,42)43)24-8-4-3-5-9-24/h3-14,19,27,29-30H,15-18,20H2,1-2H3,(H,34,41)/t27-,29-,30?/m1/s1 |
| InChIKey | LFGLIDJYWBANDJ-MODKJIOJSA-N |
| XLogP | 3.66 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |