About 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide
2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide (PubChem CID 9110830) has the molecular formula C13H22N4O4S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide |
| PubChem CID | 9110830 |
| Molecular Formula | C13H22N4O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide |
| SMILES | Cc1nn(CC(=O)N(C)C)c(C)c1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H22N4O4S/c1-10-13(22(19,20)16-5-7-21-8-6-16)11(2)17(14-10)9-12(18)15(3)4/h5-9H2,1-4H3 |
| InChIKey | OOHYTFYOFYIXAM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide (CID 9110830) is 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide is Cc1nn(CC(=O)N(C)C)c(C)c1S(=O)(=O)N1CCOCC1.
What is the InChIKey of 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide?
The InChIKey is OOHYTFYOFYIXAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O4S/c1-10-13(22(19,20)16-5-7-21-8-6-16)11(2)17(14-10)9-12(18)15(3)4/h5-9H2,1-4H3.
What are the key properties of 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide?
2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide has a molecular weight of 330.41 g/mol, XLogP of -0.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 9110830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).