C27H30F2N2O2+2 — CID 91108689
methyl 1-[2-(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)ethyl]pyridin-1-ium-2-carboxylate (PubChem CID 91108689) has the molecular formula C27H30F2N2O2+2 and a molecular weight of 452.55 g/mol. Its IUPAC name is methyl 1-[2-(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)ethyl]pyridin-1-ium-2-carboxylate.
| Compound Name | methyl 1-[2-(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)ethyl]pyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 91108689 |
| Molecular Formula | C27H30F2N2O2+2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | methyl 1-[2-(6,7-diethyl-9,11-difluoro-6-methylbenzo[a]quinolizin-5-ium-7-yl)ethyl]pyridin-1-ium-2-carboxylate |
| SMILES | CCC1(CC[n+]2ccccc2C(=O)OC)c2cc(F)cc(F)c2-c2cccc[n+]2C1(C)CC |
| InChI | InChI=1S/C27H30F2N2O2/c1-5-26(3)27(6-2,13-16-30-14-9-7-12-23(30)25(32)33-4)20-17-19(28)18-21(29)24(20)22-11-8-10-15-31(22)26/h7-12,14-15,17-18H,5-6,13,16H2,1-4H3/q+2 |
| InChIKey | YBUWKHMRZLZBKI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|