C8H13N — CID 91108838
(3E)-3-methylhepta-3,5-dien-2-imine (PubChem CID 91108838) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (3E)-3-methylhepta-3,5-dien-2-imine.
| Compound Name | (3E)-3-methylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 91108838 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (3E)-3-methylhepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C(C)=C/C=CC |
| InChI | InChI=1S/C8H13N/c1-4-5-6-7(2)8(3)9/h4-6,9H,1-3H3/b5-4?,7-6+,9-8+ |
| InChIKey | HYRDJSSKNKNTQF-FLPREWMMSA-N |
| XLogP | 2.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|