C21H26N9O+ — CID 91109323
[7-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-4-ium-6-yl]-methanidylazanium (PubChem CID 91109323) has the molecular formula C21H26N9O+ and a molecular weight of 420.50 g/mol. Its IUPAC name is [7-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-4-ium-6-yl]-methanidylazanium.
| Compound Name | [7-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-4-ium-6-yl]-methanidylazanium |
|---|---|
| PubChem CID | 91109323 |
| Molecular Formula | C21H26N9O+ |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [7-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-4-ium-6-yl]-methanidylazanium |
| SMILES | [CH2-][NH2+]C1=N[n+]2cn(-c3cnccn3)nc2/C1=N\c1ccc(N(CC)CCOC)cc1C |
| InChI | InChI=1S/C21H26N9O/c1-5-28(10-11-31-4)16-6-7-17(15(2)12-16)25-19-20(22-3)26-30-14-29(27-21(19)30)18-13-23-8-9-24-18/h6-9,12-14H,3,5,10-11,22H2,1-2,4H3/q+1/b25-19- |
| InChIKey | UNUZFOTVHKVFPX-PLRJNAJWSA-N |
| XLogP | 0.38 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|