About 6-ethyl-3H-thieno[2,3-b][1,4]thiazine
6-ethyl-3H-thieno[2,3-b][1,4]thiazine (PubChem CID 91109335) has the molecular formula C8H9NS2
and a molecular weight of 183.30 g/mol. Its IUPAC name is 6-ethyl-3H-thieno[2,3-b][1,4]thiazine.
Molecular Properties
| Compound Name | 6-ethyl-3H-thieno[2,3-b][1,4]thiazine |
| PubChem CID | 91109335 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 6-ethyl-3H-thieno[2,3-b][1,4]thiazine |
| SMILES | CCc1cc2c(s1)SCC=N2 |
| InChI | InChI=1S/C8H9NS2/c1-2-6-5-7-8(11-6)10-4-3-9-7/h3,5H,2,4H2,1H3 |
| InChIKey | ZRVNXIBPXJISQM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-3H-thieno[2,3-b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3H-thieno[2,3-b][1,4]thiazine?
The IUPAC name of 6-ethyl-3H-thieno[2,3-b][1,4]thiazine (CID 91109335) is 6-ethyl-3H-thieno[2,3-b][1,4]thiazine.
What is the SMILES notation for 6-ethyl-3H-thieno[2,3-b][1,4]thiazine?
The canonical SMILES for 6-ethyl-3H-thieno[2,3-b][1,4]thiazine is CCc1cc2c(s1)SCC=N2.
What is the InChIKey of 6-ethyl-3H-thieno[2,3-b][1,4]thiazine?
The InChIKey is ZRVNXIBPXJISQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS2/c1-2-6-5-7-8(11-6)10-4-3-9-7/h3,5H,2,4H2,1H3.
What are the key properties of 6-ethyl-3H-thieno[2,3-b][1,4]thiazine?
6-ethyl-3H-thieno[2,3-b][1,4]thiazine has a molecular weight of 183.30 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3H-thieno[2,3-b][1,4]thiazine is sourced from PubChem (CID 91109335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).