C29H43NO5S — CID 91110621
(1S,3R,11S,16R)-3-[1-(2-ethenyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91110621) has the molecular formula C29H43NO5S and a molecular weight of 517.73 g/mol. Its IUPAC name is (1S,3R,11S,16R)-3-[1-(2-ethenyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3R,11S,16R)-3-[1-(2-ethenyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91110621 |
| Molecular Formula | C29H43NO5S |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | (1S,3R,11S,16R)-3-[1-(2-ethenyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-17-oxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=Cc1nc(C=C(C)[C@H]2CC(=O)CC(O)C(C)(C)C(=O)C(C)[C@@H](O)C(C)CCC[C@@]3(C)O[C@H]3C2)cs1 |
| InChI | InChI=1S/C29H43NO5S/c1-8-25-30-21(16-36-25)12-18(3)20-13-22(31)15-23(32)28(5,6)27(34)19(4)26(33)17(2)10-9-11-29(7)24(14-20)35-29/h8,12,16-17,19-20,23-24,26,32-33H,1,9-11,13-15H2,2-7H3/t17?,19?,20-,23?,24-,26-,29+/m0/s1 |
| InChIKey | KGEYBKWDXCMBMA-GXBZTTHTSA-N |
| XLogP | 5.48 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|