C33H31F2N3O5 — CID 91110910
[(2S)-2-amino-3-phenylmethoxypropanoyl] 4-(3,4-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoate (PubChem CID 91110910) has the molecular formula C33H31F2N3O5 and a molecular weight of 587.62 g/mol. Its IUPAC name is [(2S)-2-amino-3-phenylmethoxypropanoyl] 4-(3,4-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoate.
| Compound Name | [(2S)-2-amino-3-phenylmethoxypropanoyl] 4-(3,4-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 91110910 |
| Molecular Formula | C33H31F2N3O5 |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | [(2S)-2-amino-3-phenylmethoxypropanoyl] 4-(3,4-difluorophenyl)-2-[(2,4,6-trimethylphenyl)carbamoylamino]benzoate |
| SMILES | Cc1cc(C)c(NC(=O)Nc2cc(-c3ccc(F)c(F)c3)ccc2C(=O)OC(=O)[C@@H](N)COCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C33H31F2N3O5/c1-19-13-20(2)30(21(3)14-19)38-33(41)37-29-16-24(23-10-12-26(34)27(35)15-23)9-11-25(29)31(39)43-32(40)28(36)18-42-17-22-7-5-4-6-8-22/h4-16,28H,17-18,36H2,1-3H3,(H2,37,38,41)/t28-/m0/s1 |
| InChIKey | TUYSMMOVYFKYJC-NDEPHWFRSA-N |
| XLogP | 6.43 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|